C59H112N2O9 — CID 172948395
[2-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propanoyloxymethyl]-3-(3,7,11-trimethyldodecanoyloxy)-2-(3,7,11-trimethyldodecanoyloxymethyl)propyl] 3,7,11-trimethyldodecanoate (PubChem CID 172948395) has the molecular formula C59H112N2O9 and a molecular weight of 993.55 g/mol. Its IUPAC name is [2-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propanoyloxymethyl]-3-(3,7,11-trimethyldodecanoyloxy)-2-(3,7,11-trimethyldodecanoyloxymethyl)propyl] 3,7,11-trimethyldodecanoate.
| Compound Name | [2-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propanoyloxymethyl]-3-(3,7,11-trimethyldodecanoyloxy)-2-(3,7,11-trimethyldodecanoyloxymethyl)propyl] 3,7,11-trimethyldodecanoate |
|---|---|
| PubChem CID | 172948395 |
| Molecular Formula | C59H112N2O9 |
| Molecular Weight | 993.55 g/mol |
| Exact Mass | 992.84 |
| IUPAC Name | [2-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propanoyloxymethyl]-3-(3,7,11-trimethyldodecanoyloxy)-2-(3,7,11-trimethyldodecanoyloxymethyl)propyl] 3,7,11-trimethyldodecanoate |
| SMILES | CC(C)CCCC(C)CCCC(C)CC(=O)OCC(COC(=O)CCN1CCN(CCO)CC1)(COC(=O)CC(C)CCCC(C)CCCC(C)C)COC(=O)CC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C59H112N2O9/c1-46(2)19-13-22-49(7)25-16-28-52(10)39-56(64)68-43-59(42-67-55(63)31-32-60-33-35-61(36-34-60)37-38-62,44-69-57(65)40-53(11)29-17-26-50(8)23-14-20-47(3)4)45-70-58(66)41-54(12)30-18-27-51(9)24-15-21-48(5)6/h46-54,62H,13-45H2,1-12H3 |
| InChIKey | YUNMNWCGINEQQJ-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 993.55 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|