C20H29NO4 — CID 172949414
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,3E)-2-hydroxy-3-methoxyimino-3-phenylpropanoate (PubChem CID 172949414) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,3E)-2-hydroxy-3-methoxyimino-3-phenylpropanoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,3E)-2-hydroxy-3-methoxyimino-3-phenylpropanoate |
|---|---|
| PubChem CID | 172949414 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,3E)-2-hydroxy-3-methoxyimino-3-phenylpropanoate |
| SMILES | CO/N=C(\c1ccccc1)[C@H](O)C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C20H29NO4/c1-13(2)16-11-10-14(3)12-17(16)25-20(23)19(22)18(21-24-4)15-8-6-5-7-9-15/h5-9,13-14,16-17,19,22H,10-12H2,1-4H3/b21-18+/t14-,16+,17-,19+/m1/s1 |
| InChIKey | PEWZISNOXQRJFT-PUSACPGNSA-N |
| XLogP | 3.40 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|