C22H22F2N6O — CID 172949437
(NE)-N-[[(1S,5R)-3-(4-fluoro-2-pyridinyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylidene]hydroxylamine;(1S,5R)-3-(4-fluoro-2-pyridinyl)-6-isocyano-3-azabicyclo[3.1.0]hexane (PubChem CID 172949437) has the molecular formula C22H22F2N6O and a molecular weight of 424.46 g/mol. Its IUPAC name is (NE)-N-[[(1S,5R)-3-(4-fluoro-2-pyridinyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylidene]hydroxylamine;(1S,5R)-3-(4-fluoro-2-pyridinyl)-6-isocyano-3-azabicyclo[3.1.0]hexane.
| Compound Name | (NE)-N-[[(1S,5R)-3-(4-fluoro-2-pyridinyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylidene]hydroxylamine;(1S,5R)-3-(4-fluoro-2-pyridinyl)-6-isocyano-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 172949437 |
| Molecular Formula | C22H22F2N6O |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (NE)-N-[[(1S,5R)-3-(4-fluoro-2-pyridinyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylidene]hydroxylamine;(1S,5R)-3-(4-fluoro-2-pyridinyl)-6-isocyano-3-azabicyclo[3.1.0]hexane |
| SMILES | O/N=C/C1[C@H]2CN(c3cc(F)ccn3)C[C@@H]12.[C-]#[N+]C1[C@H]2CN(c3cc(F)ccn3)C[C@@H]12 |
| InChI | InChI=1S/C11H12FN3O.C11H10FN3/c12-7-1-2-13-11(3-7)15-5-9-8(4-14-16)10(9)6-15;1-13-11-8-5-15(6-9(8)11)10-4-7(12)2-3-14-10/h1-4,8-10,16H,5-6H2;2-4,8-9,11H,5-6H2/b14-4+;/t8?,9-,10+;8-,9+,11? |
| InChIKey | DGYUAPRZOBWZKH-RKMXVPBMSA-N |
| XLogP | 2.94 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|