C24H31FN4O2 — CID 172961564
(4-fluorophenyl)-[1-[3-[(8E)-8-hydroxyimino-1-methyl-6,7-dihydro-4H-pyrrolo[3,2-c]azepin-5-yl]propyl]piperidin-4-yl]methanone (PubChem CID 172961564) has the molecular formula C24H31FN4O2 and a molecular weight of 426.54 g/mol. Its IUPAC name is (4-fluorophenyl)-[1-[3-[(8E)-8-hydroxyimino-1-methyl-6,7-dihydro-4H-pyrrolo[3,2-c]azepin-5-yl]propyl]piperidin-4-yl]methanone.
| Compound Name | (4-fluorophenyl)-[1-[3-[(8E)-8-hydroxyimino-1-methyl-6,7-dihydro-4H-pyrrolo[3,2-c]azepin-5-yl]propyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 172961564 |
| Molecular Formula | C24H31FN4O2 |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | (4-fluorophenyl)-[1-[3-[(8E)-8-hydroxyimino-1-methyl-6,7-dihydro-4H-pyrrolo[3,2-c]azepin-5-yl]propyl]piperidin-4-yl]methanone |
| SMILES | Cn1ccc2c1/C(=N/O)CCN(CCCN1CCC(C(=O)c3ccc(F)cc3)CC1)C2 |
| InChI | InChI=1S/C24H31FN4O2/c1-27-13-7-20-17-29(16-10-22(26-31)23(20)27)12-2-11-28-14-8-19(9-15-28)24(30)18-3-5-21(25)6-4-18/h3-7,13,19,31H,2,8-12,14-17H2,1H3/b26-22+ |
| InChIKey | UPRCAPHFVFDBOW-XTCLZLMSSA-N |
| XLogP | 3.53 |
| TPSA | 61.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|