C23H29FN4O2S — CID 139804324
(4-fluorophenyl)-[1-[4-[(4E)-4-hydroxyimino-2-methyl-3H-pyrrolo[2,3-e]thiazin-5-yl]butyl]piperidin-4-yl]methanone (PubChem CID 139804324) has the molecular formula C23H29FN4O2S and a molecular weight of 444.58 g/mol. Its IUPAC name is (4-fluorophenyl)-[1-[4-[(4E)-4-hydroxyimino-2-methyl-3H-pyrrolo[2,3-e]thiazin-5-yl]butyl]piperidin-4-yl]methanone.
| Compound Name | (4-fluorophenyl)-[1-[4-[(4E)-4-hydroxyimino-2-methyl-3H-pyrrolo[2,3-e]thiazin-5-yl]butyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 139804324 |
| Molecular Formula | C23H29FN4O2S |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (4-fluorophenyl)-[1-[4-[(4E)-4-hydroxyimino-2-methyl-3H-pyrrolo[2,3-e]thiazin-5-yl]butyl]piperidin-4-yl]methanone |
| SMILES | CN1C/C(=N\O)c2c(ccn2CCCCN2CCC(C(=O)c3ccc(F)cc3)CC2)S1 |
| InChI | InChI=1S/C23H29FN4O2S/c1-26-16-20(25-30)22-21(31-26)10-15-28(22)12-3-2-11-27-13-8-18(9-14-27)23(29)17-4-6-19(24)7-5-17/h4-7,10,15,18,30H,2-3,8-9,11-14,16H2,1H3/b25-20+ |
| InChIKey | BGEZDBSMBDUDPS-LKUDQCMESA-N |
| XLogP | 4.13 |
| TPSA | 61.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|