C24H29FN4O3 — CID 85268419
1-[3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl]-4-hydroxyimino-7-methyl-5,6-dihydropyrrolo[2,3-c]azepin-8-one (PubChem CID 85268419) has the molecular formula C24H29FN4O3 and a molecular weight of 440.52 g/mol. Its IUPAC name is 1-[3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl]-4-hydroxyimino-7-methyl-5,6-dihydropyrrolo[2,3-c]azepin-8-one.
| Compound Name | 1-[3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl]-4-hydroxyimino-7-methyl-5,6-dihydropyrrolo[2,3-c]azepin-8-one |
|---|---|
| PubChem CID | 85268419 |
| Molecular Formula | C24H29FN4O3 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 1-[3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl]-4-hydroxyimino-7-methyl-5,6-dihydropyrrolo[2,3-c]azepin-8-one |
| SMILES | CN1CCC(=NO)c2ccn(CCCN3CCC(C(=O)c4ccc(F)cc4)CC3)c2C1=O |
| InChI | InChI=1S/C24H29FN4O3/c1-27-13-10-21(26-32)20-9-16-29(22(20)24(27)31)12-2-11-28-14-7-18(8-15-28)23(30)17-3-5-19(25)6-4-17/h3-6,9,16,18,32H,2,7-8,10-15H2,1H3 |
| InChIKey | GCXYRQQHPIOQRA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 78.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|