C17H19N3O3S — CID 172975180
2-methyl-5-[(2E)-2-(3-methylimino-3-phenylpropylidene)hydrazinyl]benzenesulfonic acid (PubChem CID 172975180) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is 2-methyl-5-[(2E)-2-(3-methylimino-3-phenylpropylidene)hydrazinyl]benzenesulfonic acid.
| Compound Name | 2-methyl-5-[(2E)-2-(3-methylimino-3-phenylpropylidene)hydrazinyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 172975180 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-methyl-5-[(2E)-2-(3-methylimino-3-phenylpropylidene)hydrazinyl]benzenesulfonic acid |
| SMILES | C/N=C(/C/C=N/Nc1ccc(C)c(S(=O)(=O)O)c1)c1ccccc1 |
| InChI | InChI=1S/C17H19N3O3S/c1-13-8-9-15(12-17(13)24(21,22)23)20-19-11-10-16(18-2)14-6-4-3-5-7-14/h3-9,11-12,20H,10H2,1-2H3,(H,21,22,23)/b18-16-,19-11+ |
| InChIKey | UBLMFNKEZXENNF-AWNOKJFKSA-N |
| XLogP | 3.15 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|