C12H16 — CID 173019207
tetracyclo[7.2.1.02,8.03,6]dodec-10-ene (PubChem CID 173019207) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is tetracyclo[7.2.1.02,8.03,6]dodec-10-ene.
| Compound Name | tetracyclo[7.2.1.02,8.03,6]dodec-10-ene |
|---|---|
| PubChem CID | 173019207 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | tetracyclo[7.2.1.02,8.03,6]dodec-10-ene |
| SMILES | C1=CC2CC1C1CC3CCC3C21 |
| InChI | InChI=1S/C12H16/c1-2-9-5-7(1)11-6-8-3-4-10(8)12(9)11/h1-2,7-12H,3-6H2 |
| InChIKey | DLLOOLATODDARR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|