About tetracyclo[7.2.1.02,8.03,6]dodec-10-ene
tetracyclo[7.2.1.02,8.03,6]dodec-10-ene (PubChem CID 173019207) has the molecular formula C12H16
and a molecular weight of 160.26 g/mol. Its IUPAC name is tetracyclo[7.2.1.02,8.03,6]dodec-10-ene.
Molecular Properties
| Compound Name | tetracyclo[7.2.1.02,8.03,6]dodec-10-ene |
| PubChem CID | 173019207 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | tetracyclo[7.2.1.02,8.03,6]dodec-10-ene |
| SMILES | C1=CC2CC1C1CC3CCC3C21 |
| InChI | InChI=1S/C12H16/c1-2-9-5-7(1)11-6-8-3-4-10(8)12(9)11/h1-2,7-12H,3-6H2 |
| InChIKey | DLLOOLATODDARR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tetracyclo[7.2.1.02,8.03,6]dodec-10-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracyclo[7.2.1.02,8.03,6]dodec-10-ene?
The IUPAC name of tetracyclo[7.2.1.02,8.03,6]dodec-10-ene (CID 173019207) is tetracyclo[7.2.1.02,8.03,6]dodec-10-ene.
What is the SMILES notation for tetracyclo[7.2.1.02,8.03,6]dodec-10-ene?
The canonical SMILES for tetracyclo[7.2.1.02,8.03,6]dodec-10-ene is C1=CC2CC1C1CC3CCC3C21.
What is the InChIKey of tetracyclo[7.2.1.02,8.03,6]dodec-10-ene?
The InChIKey is DLLOOLATODDARR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16/c1-2-9-5-7(1)11-6-8-3-4-10(8)12(9)11/h1-2,7-12H,3-6H2.
What are the key properties of tetracyclo[7.2.1.02,8.03,6]dodec-10-ene?
tetracyclo[7.2.1.02,8.03,6]dodec-10-ene has a molecular weight of 160.26 g/mol, XLogP of 2.85, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetracyclo[7.2.1.02,8.03,6]dodec-10-ene is sourced from PubChem (CID 173019207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).