C11H13Cl3 — CID 69278155
3-(trichloromethyl)tricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 69278155) has the molecular formula C11H13Cl3 and a molecular weight of 251.58 g/mol. Its IUPAC name is 3-(trichloromethyl)tricyclo[5.2.1.02,6]dec-8-ene.
| Compound Name | 3-(trichloromethyl)tricyclo[5.2.1.02,6]dec-8-ene |
|---|---|
| PubChem CID | 69278155 |
| Molecular Formula | C11H13Cl3 |
| Molecular Weight | 251.58 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 3-(trichloromethyl)tricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | ClC(Cl)(Cl)C1CCC2C3C=CC(C3)C21 |
| InChI | InChI=1S/C11H13Cl3/c12-11(13,14)9-4-3-8-6-1-2-7(5-6)10(8)9/h1-2,6-10H,3-5H2 |
| InChIKey | DBQIVJZFRSYRJY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|