C27H42N2O3 — CID 173024941
4-[2-(5-ethyl-2-pyridinyl)ethoxy]-N-(4-hydroxycyclooctyl)-N-methylbenzamide;methane (PubChem CID 173024941) has the molecular formula C27H42N2O3 and a molecular weight of 442.64 g/mol. Its IUPAC name is 4-[2-(5-ethyl-2-pyridinyl)ethoxy]-N-(4-hydroxycyclooctyl)-N-methylbenzamide;methane.
| Compound Name | 4-[2-(5-ethyl-2-pyridinyl)ethoxy]-N-(4-hydroxycyclooctyl)-N-methylbenzamide;methane |
|---|---|
| PubChem CID | 173024941 |
| Molecular Formula | C27H42N2O3 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.32 |
| IUPAC Name | 4-[2-(5-ethyl-2-pyridinyl)ethoxy]-N-(4-hydroxycyclooctyl)-N-methylbenzamide;methane |
| SMILES | C.C.CCc1ccc(CCOc2ccc(C(=O)N(C)C3CCCCC(O)CC3)cc2)nc1 |
| InChI | InChI=1S/C25H34N2O3.2CH4/c1-3-19-8-11-21(26-18-19)16-17-30-24-14-9-20(10-15-24)25(29)27(2)22-6-4-5-7-23(28)13-12-22;;/h8-11,14-15,18,22-23,28H,3-7,12-13,16-17H2,1-2H3;2*1H4 |
| InChIKey | DNLJFHBLESZJAW-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |