About azane;chloro-hydroxy-oxosilane
azane;chloro-hydroxy-oxosilane (PubChem CID 173025886) has the molecular formula H4ClNO2Si
and a molecular weight of 113.58 g/mol. Its IUPAC name is azane;chloro-hydroxy-oxosilane.
Molecular Properties
| Compound Name | azane;chloro-hydroxy-oxosilane |
| PubChem CID | 173025886 |
| Molecular Formula | H4ClNO2Si |
| Molecular Weight | 113.58 g/mol |
| Exact Mass | 112.97 |
| IUPAC Name | azane;chloro-hydroxy-oxosilane |
| SMILES | N.O=[Si](O)Cl |
| InChI | InChI=1S/ClHO2Si.H3N/c1-4(2)3;/h2H;1H3 |
| InChIKey | DHNJUNYQQOPSDH-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.58 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze azane;chloro-hydroxy-oxosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;chloro-hydroxy-oxosilane?
The IUPAC name of azane;chloro-hydroxy-oxosilane (CID 173025886) is azane;chloro-hydroxy-oxosilane.
What is the SMILES notation for azane;chloro-hydroxy-oxosilane?
The canonical SMILES for azane;chloro-hydroxy-oxosilane is N.O=[Si](O)Cl.
What is the InChIKey of azane;chloro-hydroxy-oxosilane?
The InChIKey is DHNJUNYQQOPSDH-UHFFFAOYSA-N. The full InChI is InChI=1S/ClHO2Si.H3N/c1-4(2)3;/h2H;1H3.
What are the key properties of azane;chloro-hydroxy-oxosilane?
azane;chloro-hydroxy-oxosilane has a molecular weight of 113.58 g/mol, XLogP of -0.21, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;chloro-hydroxy-oxosilane is sourced from PubChem (CID 173025886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).