C18H11Li — CID 173034453
lithium 5H-benzo[a]anthracen-5-ide (PubChem CID 173034453) has the molecular formula C18H11Li and a molecular weight of 234.23 g/mol. Its IUPAC name is lithium 5H-benzo[a]anthracen-5-ide.
| Compound Name | lithium 5H-benzo[a]anthracen-5-ide |
|---|---|
| PubChem CID | 173034453 |
| Molecular Formula | C18H11Li |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | lithium 5H-benzo[a]anthracen-5-ide |
| SMILES | [Li+].[c-]1cc2cc3ccccc3cc2c2ccccc12 |
| InChI | InChI=1S/C18H11.Li/c1-2-7-15-12-18-16(11-14(15)6-1)10-9-13-5-3-4-8-17(13)18;/h1-8,10-12H;/q-1;+1 |
| InChIKey | DULAIZUEXFCTTM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|