C16H15Cl2N3O4 — CID 173034759
3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;2,3,4,5-tetrahydropyridine-2-carboxylic acid (PubChem CID 173034759) has the molecular formula C16H15Cl2N3O4 and a molecular weight of 384.22 g/mol. Its IUPAC name is 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;2,3,4,5-tetrahydropyridine-2-carboxylic acid.
| Compound Name | 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;2,3,4,5-tetrahydropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 173034759 |
| Molecular Formula | C16H15Cl2N3O4 |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;2,3,4,5-tetrahydropyridine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCC=N1.O=[N+]([O-])c1c(Cl)cccc1-c1c[nH]cc1Cl |
| InChI | InChI=1S/C10H6Cl2N2O2.C6H9NO2/c11-8-3-1-2-6(10(8)14(15)16)7-4-13-5-9(7)12;8-6(9)5-3-1-2-4-7-5/h1-5,13H;4-5H,1-3H2,(H,8,9) |
| InChIKey | XWHAYHMORIKFNY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|