C17H14Cl2N2O7 — CID 173187537
3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;(E)-6-oxohept-3-enedioic acid (PubChem CID 173187537) has the molecular formula C17H14Cl2N2O7 and a molecular weight of 429.21 g/mol. Its IUPAC name is 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;(E)-6-oxohept-3-enedioic acid.
| Compound Name | 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;(E)-6-oxohept-3-enedioic acid |
|---|---|
| PubChem CID | 173187537 |
| Molecular Formula | C17H14Cl2N2O7 |
| Molecular Weight | 429.21 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;(E)-6-oxohept-3-enedioic acid |
| SMILES | O=C(O)C/C=C/CC(=O)C(=O)O.O=[N+]([O-])c1c(Cl)cccc1-c1c[nH]cc1Cl |
| InChI | InChI=1S/C10H6Cl2N2O2.C7H8O5/c11-8-3-1-2-6(10(8)14(15)16)7-4-13-5-9(7)12;8-5(7(11)12)3-1-2-4-6(9)10/h1-5,13H;1-2H,3-4H2,(H,9,10)(H,11,12)/b;2-1+ |
| InChIKey | DEXHNWVNDCABGP-WLHGVMLRSA-N |
| XLogP | 3.96 |
| TPSA | 150.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.21 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|