C15H15Cl2N3O5 — CID 22149640
5-amino-4-oxopentanoic acid;3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole (PubChem CID 22149640) has the molecular formula C15H15Cl2N3O5 and a molecular weight of 388.21 g/mol. Its IUPAC name is 5-amino-4-oxopentanoic acid;3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole.
| Compound Name | 5-amino-4-oxopentanoic acid;3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole |
|---|---|
| PubChem CID | 22149640 |
| Molecular Formula | C15H15Cl2N3O5 |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 5-amino-4-oxopentanoic acid;3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole |
| SMILES | NCC(=O)CCC(=O)O.O=[N+]([O-])c1c(Cl)cccc1-c1c[nH]cc1Cl |
| InChI | InChI=1S/C10H6Cl2N2O2.C5H9NO3/c11-8-3-1-2-6(10(8)14(15)16)7-4-13-5-9(7)12;6-3-4(7)1-2-5(8)9/h1-5,13H;1-3,6H2,(H,8,9) |
| InChIKey | OQNUIWXYLHENBQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 139.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|