About 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;3-oxohexanedial
3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;3-oxohexanedial (PubChem CID 18538324) has the molecular formula C16H14Cl2N2O5
and a molecular weight of 385.20 g/mol. Its IUPAC name is 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;3-oxohexanedial.
Molecular Properties
| Compound Name | 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;3-oxohexanedial |
| PubChem CID | 18538324 |
| Molecular Formula | C16H14Cl2N2O5 |
| Molecular Weight | 385.20 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;3-oxohexanedial |
| SMILES | O=CCCC(=O)CC=O.O=[N+]([O-])c1c(Cl)cccc1-c1c[nH]cc1Cl |
| InChI | InChI=1S/C10H6Cl2N2O2.C6H8O3/c11-8-3-1-2-6(10(8)14(15)16)7-4-13-5-9(7)12;7-4-1-2-6(9)3-5-8/h1-5,13H;4-5H,1-3H2 |
| InChIKey | GPQJQIXYARSTLN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.20 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;3-oxohexanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;3-oxohexanedial?
The IUPAC name of 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;3-oxohexanedial (CID 18538324) is 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;3-oxohexanedial.
What is the SMILES notation for 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;3-oxohexanedial?
The canonical SMILES for 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;3-oxohexanedial is O=CCCC(=O)CC=O.O=[N+]([O-])c1c(Cl)cccc1-c1c[nH]cc1Cl.
What is the InChIKey of 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;3-oxohexanedial?
The InChIKey is GPQJQIXYARSTLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Cl2N2O2.C6H8O3/c11-8-3-1-2-6(10(8)14(15)16)7-4-13-5-9(7)12;7-4-1-2-6(9)3-5-8/h1-5,13H;4-5H,1-3H2.
What are the key properties of 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;3-oxohexanedial?
3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;3-oxohexanedial has a molecular weight of 385.20 g/mol, XLogP of 4.02, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole;3-oxohexanedial is sourced from PubChem (CID 18538324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).