C7H12N2O3 — CID 173037567
1,1-bis(3-hydroxyprop-2-enyl)urea (PubChem CID 173037567) has the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. Its IUPAC name is 1,1-bis(3-hydroxyprop-2-enyl)urea.
| Compound Name | 1,1-bis(3-hydroxyprop-2-enyl)urea |
|---|---|
| PubChem CID | 173037567 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 1,1-bis(3-hydroxyprop-2-enyl)urea |
| SMILES | NC(=O)N(CC=CO)CC=CO |
| InChI | InChI=1S/C7H12N2O3/c8-7(12)9(3-1-5-10)4-2-6-11/h1-2,5-6,10-11H,3-4H2,(H2,8,12) |
| InChIKey | HHZOSAXFSNHQMZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|