C17H27N5O6 — CID 173041164
N-[2-[3-(2,5-dioxopyrrolidin-1-yl)propanoylamino]ethyl]-6,6-diformamidohexanamide (PubChem CID 173041164) has the molecular formula C17H27N5O6 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-[2-[3-(2,5-dioxopyrrolidin-1-yl)propanoylamino]ethyl]-6,6-diformamidohexanamide.
| Compound Name | N-[2-[3-(2,5-dioxopyrrolidin-1-yl)propanoylamino]ethyl]-6,6-diformamidohexanamide |
|---|---|
| PubChem CID | 173041164 |
| Molecular Formula | C17H27N5O6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-[2-[3-(2,5-dioxopyrrolidin-1-yl)propanoylamino]ethyl]-6,6-diformamidohexanamide |
| SMILES | O=CNC(CCCCC(=O)NCCNC(=O)CCN1C(=O)CCC1=O)NC=O |
| InChI | InChI=1S/C17H27N5O6/c23-11-20-13(21-12-24)3-1-2-4-14(25)18-8-9-19-15(26)7-10-22-16(27)5-6-17(22)28/h11-13H,1-10H2,(H,18,25)(H,19,26)(H,20,23)(H,21,24) |
| InChIKey | WFOFGOPFMNEDLZ-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|