C30H65ClN2O2 — CID 173054970
2-amino-3,3-dimethylhexan-2-ol;docosanamide;hydrochloride (PubChem CID 173054970) has the molecular formula C30H65ClN2O2 and a molecular weight of 521.32 g/mol. Its IUPAC name is 2-amino-3,3-dimethylhexan-2-ol;docosanamide;hydrochloride.
| Compound Name | 2-amino-3,3-dimethylhexan-2-ol;docosanamide;hydrochloride |
|---|---|
| PubChem CID | 173054970 |
| Molecular Formula | C30H65ClN2O2 |
| Molecular Weight | 521.32 g/mol |
| Exact Mass | 520.47 |
| IUPAC Name | 2-amino-3,3-dimethylhexan-2-ol;docosanamide;hydrochloride |
| SMILES | CCCC(C)(C)C(C)(N)O.CCCCCCCCCCCCCCCCCCCCCC(N)=O.Cl |
| InChI | InChI=1S/C22H45NO.C8H19NO.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-5-6-7(2,3)8(4,9)10;/h2-21H2,1H3,(H2,23,24);10H,5-6,9H2,1-4H3;1H |
| InChIKey | CZWJYLMNMUYFPA-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.32 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|