C23H25F3O3S2 — CID 173055994
1,1'-biphenyl;4-(2-methylpropyl)benzenethiol;trifluoromethanesulfonic acid (PubChem CID 173055994) has the molecular formula C23H25F3O3S2 and a molecular weight of 470.58 g/mol. Its IUPAC name is 1,1'-biphenyl;4-(2-methylpropyl)benzenethiol;trifluoromethanesulfonic acid.
| Compound Name | 1,1'-biphenyl;4-(2-methylpropyl)benzenethiol;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 173055994 |
| Molecular Formula | C23H25F3O3S2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 1,1'-biphenyl;4-(2-methylpropyl)benzenethiol;trifluoromethanesulfonic acid |
| SMILES | CC(C)Cc1ccc(S)cc1.O=S(=O)(O)C(F)(F)F.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C10H14S.CHF3O3S/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-8(2)7-9-3-5-10(11)6-4-9;2-1(3,4)8(5,6)7/h1-10H;3-6,8,11H,7H2,1-2H3;(H,5,6,7) |
| InChIKey | PWLMKMBUCCLJPC-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|