C25H23N2O5P — CID 173060226
butan-2-yloxy-[2-(8-naphthalen-1-yl-6-nitroquinolin-2-yl)ethenyl]phosphinic acid (PubChem CID 173060226) has the molecular formula C25H23N2O5P and a molecular weight of 462.44 g/mol. Its IUPAC name is butan-2-yloxy-[2-(8-naphthalen-1-yl-6-nitroquinolin-2-yl)ethenyl]phosphinic acid.
| Compound Name | butan-2-yloxy-[2-(8-naphthalen-1-yl-6-nitroquinolin-2-yl)ethenyl]phosphinic acid |
|---|---|
| PubChem CID | 173060226 |
| Molecular Formula | C25H23N2O5P |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | butan-2-yloxy-[2-(8-naphthalen-1-yl-6-nitroquinolin-2-yl)ethenyl]phosphinic acid |
| SMILES | CCC(C)OP(=O)(O)C=Cc1ccc2cc([N+](=O)[O-])cc(-c3cccc4ccccc34)c2n1 |
| InChI | InChI=1S/C25H23N2O5P/c1-3-17(2)32-33(30,31)14-13-20-12-11-19-15-21(27(28)29)16-24(25(19)26-20)23-10-6-8-18-7-4-5-9-22(18)23/h4-17H,3H2,1-2H3,(H,30,31) |
| InChIKey | BSPPIXJHRSYLGA-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|