C25H25N2O3P — CID 173060249
2-(6-amino-8-naphthalen-1-ylquinolin-2-yl)ethenyl-butan-2-yloxyphosphinic acid (PubChem CID 173060249) has the molecular formula C25H25N2O3P and a molecular weight of 432.46 g/mol. Its IUPAC name is 2-(6-amino-8-naphthalen-1-ylquinolin-2-yl)ethenyl-butan-2-yloxyphosphinic acid.
| Compound Name | 2-(6-amino-8-naphthalen-1-ylquinolin-2-yl)ethenyl-butan-2-yloxyphosphinic acid |
|---|---|
| PubChem CID | 173060249 |
| Molecular Formula | C25H25N2O3P |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-(6-amino-8-naphthalen-1-ylquinolin-2-yl)ethenyl-butan-2-yloxyphosphinic acid |
| SMILES | CCC(C)OP(=O)(O)C=Cc1ccc2cc(N)cc(-c3cccc4ccccc34)c2n1 |
| InChI | InChI=1S/C25H25N2O3P/c1-3-17(2)30-31(28,29)14-13-21-12-11-19-15-20(26)16-24(25(19)27-21)23-10-6-8-18-7-4-5-9-22(18)23/h4-17H,3,26H2,1-2H3,(H,28,29) |
| InChIKey | ZFIHISXHQIVMES-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|