C15H25NO5 — CID 173061112
1-[(4-formylcyclohexyl)methylcarbamoyloxy]ethyl 2-methylpropanoate (PubChem CID 173061112) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-[(4-formylcyclohexyl)methylcarbamoyloxy]ethyl 2-methylpropanoate.
| Compound Name | 1-[(4-formylcyclohexyl)methylcarbamoyloxy]ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 173061112 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1-[(4-formylcyclohexyl)methylcarbamoyloxy]ethyl 2-methylpropanoate |
| SMILES | CC(OC(=O)NCC1CCC(C=O)CC1)OC(=O)C(C)C |
| InChI | InChI=1S/C15H25NO5/c1-10(2)14(18)20-11(3)21-15(19)16-8-12-4-6-13(9-17)7-5-12/h9-13H,4-8H2,1-3H3,(H,16,19) |
| InChIKey | LQBNGJYSFKVAIW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|