C15H24NNaO6 — CID 66841781
sodium 4-[[[(1S)-1-(2-methylpropanoyloxy)ethoxy]carbonylamino]methyl]cyclohexane-1-carboxylate (PubChem CID 66841781) has the molecular formula C15H24NNaO6 and a molecular weight of 337.35 g/mol. Its IUPAC name is sodium 4-[[[(1S)-1-(2-methylpropanoyloxy)ethoxy]carbonylamino]methyl]cyclohexane-1-carboxylate.
| Compound Name | sodium 4-[[[(1S)-1-(2-methylpropanoyloxy)ethoxy]carbonylamino]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 66841781 |
| Molecular Formula | C15H24NNaO6 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | sodium 4-[[[(1S)-1-(2-methylpropanoyloxy)ethoxy]carbonylamino]methyl]cyclohexane-1-carboxylate |
| SMILES | CC(C)C(=O)O[C@H](C)OC(=O)NCC1CCC(C(=O)[O-])CC1.[Na+] |
| InChI | InChI=1S/C15H25NO6.Na/c1-9(2)14(19)21-10(3)22-15(20)16-8-11-4-6-12(7-5-11)13(17)18;/h9-12H,4-8H2,1-3H3,(H,16,20)(H,17,18);/q;+1/p-1/t10-,11?,12?;/m0./s1 |
| InChIKey | IPXSAAJZUONPAI-YGKYINHESA-M |
| XLogP | -2.18 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|