C10H17N2O3+ — CID 173083001
(3,4-dihydroxyphenyl)methyl-(2-hydroxyethylamino)-methylazanium (PubChem CID 173083001) has the molecular formula C10H17N2O3+ and a molecular weight of 213.26 g/mol. Its IUPAC name is (3,4-dihydroxyphenyl)methyl-(2-hydroxyethylamino)-methylazanium.
| Compound Name | (3,4-dihydroxyphenyl)methyl-(2-hydroxyethylamino)-methylazanium |
|---|---|
| PubChem CID | 173083001 |
| Molecular Formula | C10H17N2O3+ |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | (3,4-dihydroxyphenyl)methyl-(2-hydroxyethylamino)-methylazanium |
| SMILES | C[NH+](Cc1ccc(O)c(O)c1)NCCO |
| InChI | InChI=1S/C10H16N2O3/c1-12(11-4-5-13)7-8-2-3-9(14)10(15)6-8/h2-3,6,11,13-15H,4-5,7H2,1H3/p+1 |
| InChIKey | AIGJJIVGZMSKPC-UHFFFAOYSA-O |
| XLogP | -1.39 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|