C19H21N4NaO3S — CID 173085268
sodium;hydride;2-[(4-methoxy-3-methyl-2-pyridinyl)methylsulfinyl]-5-pent-3-ynoxy-1H-imidazo[4,5-b]pyridine (PubChem CID 173085268) has the molecular formula C19H21N4NaO3S and a molecular weight of 408.46 g/mol. Its IUPAC name is sodium;hydride;2-[(4-methoxy-3-methyl-2-pyridinyl)methylsulfinyl]-5-pent-3-ynoxy-1H-imidazo[4,5-b]pyridine.
| Compound Name | sodium;hydride;2-[(4-methoxy-3-methyl-2-pyridinyl)methylsulfinyl]-5-pent-3-ynoxy-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 173085268 |
| Molecular Formula | C19H21N4NaO3S |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | sodium;hydride;2-[(4-methoxy-3-methyl-2-pyridinyl)methylsulfinyl]-5-pent-3-ynoxy-1H-imidazo[4,5-b]pyridine |
| SMILES | CC#CCCOc1ccc2[nH]c(S(=O)Cc3nccc(OC)c3C)nc2n1.[H-].[Na+] |
| InChI | InChI=1S/C19H20N4O3S.Na.H/c1-4-5-6-11-26-17-8-7-14-18(22-17)23-19(21-14)27(24)12-15-13(2)16(25-3)9-10-20-15;;/h7-10H,6,11-12H2,1-3H3,(H,21,22,23);;/q;+1;-1 |
| InChIKey | DPWCNSGOIVUWTA-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|