C19H15N3O3S — CID 17308896
(2-acetylphenyl) 2-[(6-phenyl-1,2,4-triazin-3-yl)sulfanyl]acetate (PubChem CID 17308896) has the molecular formula C19H15N3O3S and a molecular weight of 365.41 g/mol. Its IUPAC name is (2-acetylphenyl) 2-[(6-phenyl-1,2,4-triazin-3-yl)sulfanyl]acetate.
| Compound Name | (2-acetylphenyl) 2-[(6-phenyl-1,2,4-triazin-3-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 17308896 |
| Molecular Formula | C19H15N3O3S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | (2-acetylphenyl) 2-[(6-phenyl-1,2,4-triazin-3-yl)sulfanyl]acetate |
| SMILES | CC(=O)c1ccccc1OC(=O)CSc1ncc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C19H15N3O3S/c1-13(23)15-9-5-6-10-17(15)25-18(24)12-26-19-20-11-16(21-22-19)14-7-3-2-4-8-14/h2-11H,12H2,1H3 |
| InChIKey | QVGALEAMDQBGMQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|