C29H33BrCl2N4O6 — CID 173091736
[2-[4-[(2-bromoacetyl)amino]-3,5-dichlorophenyl]-1-[[3-ethoxyimino-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-3,3-dimethylbutylidene]carbamic acid (PubChem CID 173091736) has the molecular formula C29H33BrCl2N4O6 and a molecular weight of 684.41 g/mol. Its IUPAC name is [2-[4-[(2-bromoacetyl)amino]-3,5-dichlorophenyl]-1-[[3-ethoxyimino-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-3,3-dimethylbutylidene]carbamic acid.
| Compound Name | [2-[4-[(2-bromoacetyl)amino]-3,5-dichlorophenyl]-1-[[3-ethoxyimino-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-3,3-dimethylbutylidene]carbamic acid |
|---|---|
| PubChem CID | 173091736 |
| Molecular Formula | C29H33BrCl2N4O6 |
| Molecular Weight | 684.41 g/mol |
| Exact Mass | 682.10 |
| IUPAC Name | [2-[4-[(2-bromoacetyl)amino]-3,5-dichlorophenyl]-1-[[3-ethoxyimino-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-3,3-dimethylbutylidene]carbamic acid |
| SMILES | C=CCOc1ccc(C(CC(=O)NC(=NC(=O)O)C(c2cc(Cl)c(NC(=O)CBr)c(Cl)c2)C(C)(C)C)=NOCC)cc1 |
| InChI | InChI=1S/C29H33BrCl2N4O6/c1-6-12-41-19-10-8-17(9-11-19)22(36-42-7-2)15-23(37)34-27(35-28(39)40)25(29(3,4)5)18-13-20(31)26(21(32)14-18)33-24(38)16-30/h6,8-11,13-14,25H,1,7,12,15-16H2,2-5H3,(H,33,38)(H,39,40)(H,34,35,37) |
| InChIKey | ORGRRQCKVMSIPS-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.41 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|