C34H43Cl2N5O6 — CID 173092050
[2-[3,5-dichloro-4-[[2-(pent-4-enylamino)acetyl]amino]phenyl]-1-[[3-ethoxyimino-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-3,3-dimethylbutylidene]carbamic acid (PubChem CID 173092050) has the molecular formula C34H43Cl2N5O6 and a molecular weight of 688.65 g/mol. Its IUPAC name is [2-[3,5-dichloro-4-[[2-(pent-4-enylamino)acetyl]amino]phenyl]-1-[[3-ethoxyimino-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-3,3-dimethylbutylidene]carbamic acid.
| Compound Name | [2-[3,5-dichloro-4-[[2-(pent-4-enylamino)acetyl]amino]phenyl]-1-[[3-ethoxyimino-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-3,3-dimethylbutylidene]carbamic acid |
|---|---|
| PubChem CID | 173092050 |
| Molecular Formula | C34H43Cl2N5O6 |
| Molecular Weight | 688.65 g/mol |
| Exact Mass | 687.26 |
| IUPAC Name | [2-[3,5-dichloro-4-[[2-(pent-4-enylamino)acetyl]amino]phenyl]-1-[[3-ethoxyimino-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-3,3-dimethylbutylidene]carbamic acid |
| SMILES | C=CCCCNCC(=O)Nc1c(Cl)cc(C(C(=NC(=O)O)NC(=O)CC(=NOCC)c2ccc(OCC=C)cc2)C(C)(C)C)cc1Cl |
| InChI | InChI=1S/C34H43Cl2N5O6/c1-7-10-11-16-37-21-29(43)38-31-25(35)18-23(19-26(31)36)30(34(4,5)6)32(40-33(44)45)39-28(42)20-27(41-47-9-3)22-12-14-24(15-13-22)46-17-8-2/h7-8,12-15,18-19,30,37H,1-2,9-11,16-17,20-21H2,3-6H3,(H,38,43)(H,44,45)(H,39,40,42) |
| InChIKey | VGJIVNYNKZFCBQ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 150.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.65 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|