C32H36Cl2N6O6 — CID 59340961
tert-butyl N-[N'-[[3,5-dichloro-4-[[2-(prop-2-enylamino)acetyl]amino]phenyl]methyl]-N-[5-methyl-3-(4-prop-2-enoxyphenyl)-1,2-oxazole-4-carbonyl]carbamimidoyl]carbamate (PubChem CID 59340961) has the molecular formula C32H36Cl2N6O6 and a molecular weight of 671.58 g/mol. Its IUPAC name is tert-butyl N-[N'-[[3,5-dichloro-4-[[2-(prop-2-enylamino)acetyl]amino]phenyl]methyl]-N-[5-methyl-3-(4-prop-2-enoxyphenyl)-1,2-oxazole-4-carbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[[3,5-dichloro-4-[[2-(prop-2-enylamino)acetyl]amino]phenyl]methyl]-N-[5-methyl-3-(4-prop-2-enoxyphenyl)-1,2-oxazole-4-carbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 59340961 |
| Molecular Formula | C32H36Cl2N6O6 |
| Molecular Weight | 671.58 g/mol |
| Exact Mass | 670.21 |
| IUPAC Name | tert-butyl N-[N'-[[3,5-dichloro-4-[[2-(prop-2-enylamino)acetyl]amino]phenyl]methyl]-N-[5-methyl-3-(4-prop-2-enoxyphenyl)-1,2-oxazole-4-carbonyl]carbamimidoyl]carbamate |
| SMILES | C=CCNCC(=O)Nc1c(Cl)cc(C/N=C(\NC(=O)OC(C)(C)C)NC(=O)c2c(-c3ccc(OCC=C)cc3)noc2C)cc1Cl |
| InChI | InChI=1S/C32H36Cl2N6O6/c1-7-13-35-18-25(41)37-28-23(33)15-20(16-24(28)34)17-36-30(39-31(43)45-32(4,5)6)38-29(42)26-19(3)46-40-27(26)21-9-11-22(12-10-21)44-14-8-2/h7-12,15-16,35H,1-2,13-14,17-18H2,3-6H3,(H,37,41)(H2,36,38,39,42,43) |
| InChIKey | CNFHOPVTHIUHOB-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 156.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.58 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|