C27H31Cl2N5O4 — CID 58986311
tert-butyl N-[N'-[(4-acetamido-3,5-dichlorophenyl)methyl]-N-(3-phenyl-3-azabicyclo[3.1.0]hexane-2-carbonyl)carbamimidoyl]carbamate (PubChem CID 58986311) has the molecular formula C27H31Cl2N5O4 and a molecular weight of 560.48 g/mol. Its IUPAC name is tert-butyl N-[N'-[(4-acetamido-3,5-dichlorophenyl)methyl]-N-(3-phenyl-3-azabicyclo[3.1.0]hexane-2-carbonyl)carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[(4-acetamido-3,5-dichlorophenyl)methyl]-N-(3-phenyl-3-azabicyclo[3.1.0]hexane-2-carbonyl)carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 58986311 |
| Molecular Formula | C27H31Cl2N5O4 |
| Molecular Weight | 560.48 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | tert-butyl N-[N'-[(4-acetamido-3,5-dichlorophenyl)methyl]-N-(3-phenyl-3-azabicyclo[3.1.0]hexane-2-carbonyl)carbamimidoyl]carbamate |
| SMILES | CC(=O)Nc1c(Cl)cc(C/N=C(\NC(=O)OC(C)(C)C)NC(=O)C2C3CC3CN2c2ccccc2)cc1Cl |
| InChI | InChI=1S/C27H31Cl2N5O4/c1-15(35)31-22-20(28)10-16(11-21(22)29)13-30-25(33-26(37)38-27(2,3)4)32-24(36)23-19-12-17(19)14-34(23)18-8-6-5-7-9-18/h5-11,17,19,23H,12-14H2,1-4H3,(H,31,35)(H2,30,32,33,36,37) |
| InChIKey | ZMTAYAAHMMNTFF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|