C28H28Cl2N6O6 — CID 173095502
[N-[[3,5-dichloro-4-[[2-(prop-2-enylamino)acetyl]amino]phenyl]methyl]-N-[5-methyl-3-(4-prop-2-enoxyphenyl)-1,2-oxazole-4-carbonyl]carbamimidoyl]carbamic acid (PubChem CID 173095502) has the molecular formula C28H28Cl2N6O6 and a molecular weight of 615.47 g/mol. Its IUPAC name is [N-[[3,5-dichloro-4-[[2-(prop-2-enylamino)acetyl]amino]phenyl]methyl]-N-[5-methyl-3-(4-prop-2-enoxyphenyl)-1,2-oxazole-4-carbonyl]carbamimidoyl]carbamic acid.
| Compound Name | [N-[[3,5-dichloro-4-[[2-(prop-2-enylamino)acetyl]amino]phenyl]methyl]-N-[5-methyl-3-(4-prop-2-enoxyphenyl)-1,2-oxazole-4-carbonyl]carbamimidoyl]carbamic acid |
|---|---|
| PubChem CID | 173095502 |
| Molecular Formula | C28H28Cl2N6O6 |
| Molecular Weight | 615.47 g/mol |
| Exact Mass | 614.14 |
| IUPAC Name | [N-[[3,5-dichloro-4-[[2-(prop-2-enylamino)acetyl]amino]phenyl]methyl]-N-[5-methyl-3-(4-prop-2-enoxyphenyl)-1,2-oxazole-4-carbonyl]carbamimidoyl]carbamic acid |
| SMILES | [H]/N=C(\NC(=O)O)N(Cc1cc(Cl)c(NC(=O)CNCC=C)c(Cl)c1)C(=O)c1c(-c2ccc(OCC=C)cc2)noc1C |
| InChI | InChI=1S/C28H28Cl2N6O6/c1-4-10-32-14-22(37)33-25-20(29)12-17(13-21(25)30)15-36(27(31)34-28(39)40)26(38)23-16(3)42-35-24(23)18-6-8-19(9-7-18)41-11-5-2/h4-9,12-13,32H,1-2,10-11,14-15H2,3H3,(H2,31,34)(H,33,37)(H,39,40) |
| InChIKey | TVUJEYILRCYEJR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 169.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|