C25H23BrClN5O5S — CID 173095525
[N-[[4-[(2-bromoacetyl)amino]-3-chlorophenyl]methyl]-N-[5-methyl-3-(4-prop-2-enoxyphenyl)-1,2-thiazole-4-carbonyl]carbamimidoyl]carbamic acid (PubChem CID 173095525) has the molecular formula C25H23BrClN5O5S and a molecular weight of 620.91 g/mol. Its IUPAC name is [N-[[4-[(2-bromoacetyl)amino]-3-chlorophenyl]methyl]-N-[5-methyl-3-(4-prop-2-enoxyphenyl)-1,2-thiazole-4-carbonyl]carbamimidoyl]carbamic acid.
| Compound Name | [N-[[4-[(2-bromoacetyl)amino]-3-chlorophenyl]methyl]-N-[5-methyl-3-(4-prop-2-enoxyphenyl)-1,2-thiazole-4-carbonyl]carbamimidoyl]carbamic acid |
|---|---|
| PubChem CID | 173095525 |
| Molecular Formula | C25H23BrClN5O5S |
| Molecular Weight | 620.91 g/mol |
| Exact Mass | 619.03 |
| IUPAC Name | [N-[[4-[(2-bromoacetyl)amino]-3-chlorophenyl]methyl]-N-[5-methyl-3-(4-prop-2-enoxyphenyl)-1,2-thiazole-4-carbonyl]carbamimidoyl]carbamic acid |
| SMILES | [H]/N=C(\NC(=O)O)N(Cc1ccc(NC(=O)CBr)c(Cl)c1)C(=O)c1c(-c2ccc(OCC=C)cc2)nsc1C |
| InChI | InChI=1S/C25H23BrClN5O5S/c1-3-10-37-17-7-5-16(6-8-17)22-21(14(2)38-31-22)23(34)32(24(28)30-25(35)36)13-15-4-9-19(18(27)11-15)29-20(33)12-26/h3-9,11H,1,10,12-13H2,2H3,(H2,28,30)(H,29,33)(H,35,36) |
| InChIKey | PNDKYYJFFRSODT-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.91 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|