C29H30BrCl2N5O6 — CID 173095647
tert-butyl N-[N-[[4-[(2-bromoacetyl)amino]-3,5-dichlorophenyl]methyl]-N-[5-methyl-3-(4-prop-2-enoxyphenyl)-1,2-oxazole-4-carbonyl]carbamimidoyl]carbamate (PubChem CID 173095647) has the molecular formula C29H30BrCl2N5O6 and a molecular weight of 695.40 g/mol. Its IUPAC name is tert-butyl N-[N-[[4-[(2-bromoacetyl)amino]-3,5-dichlorophenyl]methyl]-N-[5-methyl-3-(4-prop-2-enoxyphenyl)-1,2-oxazole-4-carbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N-[[4-[(2-bromoacetyl)amino]-3,5-dichlorophenyl]methyl]-N-[5-methyl-3-(4-prop-2-enoxyphenyl)-1,2-oxazole-4-carbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 173095647 |
| Molecular Formula | C29H30BrCl2N5O6 |
| Molecular Weight | 695.40 g/mol |
| Exact Mass | 693.08 |
| IUPAC Name | tert-butyl N-[N-[[4-[(2-bromoacetyl)amino]-3,5-dichlorophenyl]methyl]-N-[5-methyl-3-(4-prop-2-enoxyphenyl)-1,2-oxazole-4-carbonyl]carbamimidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)N(Cc1cc(Cl)c(NC(=O)CBr)c(Cl)c1)C(=O)c1c(-c2ccc(OCC=C)cc2)noc1C |
| InChI | InChI=1S/C29H30BrCl2N5O6/c1-6-11-41-19-9-7-18(8-10-19)24-23(16(2)43-36-24)26(39)37(27(33)35-28(40)42-29(3,4)5)15-17-12-20(31)25(21(32)13-17)34-22(38)14-30/h6-10,12-13H,1,11,14-15H2,2-5H3,(H,34,38)(H2,33,35,40) |
| InChIKey | HPRYKLCEDZGYNU-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 146.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.40 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|