C32H49N5O7S — CID 173093856
ethyl piperazine-1-carboxylate;3-[2-(N'-hydroxycarbamimidoyl)phenyl]-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]propanoic acid (PubChem CID 173093856) has the molecular formula C32H49N5O7S and a molecular weight of 647.84 g/mol. Its IUPAC name is ethyl piperazine-1-carboxylate;3-[2-(N'-hydroxycarbamimidoyl)phenyl]-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]propanoic acid.
| Compound Name | ethyl piperazine-1-carboxylate;3-[2-(N'-hydroxycarbamimidoyl)phenyl]-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 173093856 |
| Molecular Formula | C32H49N5O7S |
| Molecular Weight | 647.84 g/mol |
| Exact Mass | 647.34 |
| IUPAC Name | ethyl piperazine-1-carboxylate;3-[2-(N'-hydroxycarbamimidoyl)phenyl]-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]propanoic acid |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)NC(Cc2ccccc2C(N)=NO)C(=O)O)c(C(C)C)c1.CCOC(=O)N1CCNCC1 |
| InChI | InChI=1S/C25H35N3O5S.C7H14N2O2/c1-14(2)18-11-20(15(3)4)23(21(12-18)16(5)6)34(32,33)28-22(25(29)30)13-17-9-7-8-10-19(17)24(26)27-31;1-2-11-7(10)9-5-3-8-4-6-9/h7-12,14-16,22,28,31H,13H2,1-6H3,(H2,26,27)(H,29,30);8H,2-6H2,1H3 |
| InChIKey | BNMIKTJXVUMSIL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 183.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.84 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|