C19H22NO3+ — CID 173098641
1,3-benzodioxol-5-yl-diethyl-(4-methylbenzoyl)azanium (PubChem CID 173098641) has the molecular formula C19H22NO3+ and a molecular weight of 312.39 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-diethyl-(4-methylbenzoyl)azanium.
| Compound Name | 1,3-benzodioxol-5-yl-diethyl-(4-methylbenzoyl)azanium |
|---|---|
| PubChem CID | 173098641 |
| Molecular Formula | C19H22NO3+ |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1,3-benzodioxol-5-yl-diethyl-(4-methylbenzoyl)azanium |
| SMILES | CC[N+](CC)(C(=O)c1ccc(C)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H22NO3/c1-4-20(5-2,19(21)15-8-6-14(3)7-9-15)16-10-11-17-18(12-16)23-13-22-17/h6-12H,4-5,13H2,1-3H3/q+1 |
| InChIKey | FFKRHNALUKNHHM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|