About dihydrogen borate;4-methoxybenzenediazonium
dihydrogen borate;4-methoxybenzenediazonium (PubChem CID 173109406) has the molecular formula C7H9BN2O4
and a molecular weight of 195.97 g/mol. Its IUPAC name is dihydrogen borate;4-methoxybenzenediazonium.
Molecular Properties
| Compound Name | dihydrogen borate;4-methoxybenzenediazonium |
| PubChem CID | 173109406 |
| Molecular Formula | C7H9BN2O4 |
| Molecular Weight | 195.97 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | dihydrogen borate;4-methoxybenzenediazonium |
| SMILES | COc1ccc([N+]#N)cc1.[O-]B(O)O |
| InChI | InChI=1S/C7H7N2O.BH2O3/c1-10-7-4-2-6(9-8)3-5-7;2-1(3)4/h2-5H,1H3;2-3H/q+1;-1 |
| InChIKey | RXNATHQFIFBNDK-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.97 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dihydrogen borate;4-methoxybenzenediazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydrogen borate;4-methoxybenzenediazonium?
The IUPAC name of dihydrogen borate;4-methoxybenzenediazonium (CID 173109406) is dihydrogen borate;4-methoxybenzenediazonium.
What is the SMILES notation for dihydrogen borate;4-methoxybenzenediazonium?
The canonical SMILES for dihydrogen borate;4-methoxybenzenediazonium is COc1ccc([N+]#N)cc1.[O-]B(O)O.
What is the InChIKey of dihydrogen borate;4-methoxybenzenediazonium?
The InChIKey is RXNATHQFIFBNDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N2O.BH2O3/c1-10-7-4-2-6(9-8)3-5-7;2-1(3)4/h2-5H,1H3;2-3H/q+1;-1.
What are the key properties of dihydrogen borate;4-methoxybenzenediazonium?
dihydrogen borate;4-methoxybenzenediazonium has a molecular weight of 195.97 g/mol, XLogP of -0.50, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dihydrogen borate;4-methoxybenzenediazonium is sourced from PubChem (CID 173109406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).