C13H23NO4Si — CID 173112912
methyl 5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-methyl-1,3-oxazole-2-carboxylate (PubChem CID 173112912) has the molecular formula C13H23NO4Si and a molecular weight of 285.42 g/mol. Its IUPAC name is methyl 5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-methyl-1,3-oxazole-2-carboxylate.
| Compound Name | methyl 5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-methyl-1,3-oxazole-2-carboxylate |
|---|---|
| PubChem CID | 173112912 |
| Molecular Formula | C13H23NO4Si |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | methyl 5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-methyl-1,3-oxazole-2-carboxylate |
| SMILES | COC(=O)c1nc(C)c(C(O[SiH](C)C)C(C)(C)C)o1 |
| InChI | InChI=1S/C13H23NO4Si/c1-8-9(17-11(14-8)12(15)16-5)10(13(2,3)4)18-19(6)7/h10,19H,1-7H3 |
| InChIKey | QROFVGSRGPCEAV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|