C15H11BrFNOS — CID 173117931
2-(1,3-benzothiazol-2-yl)-2-(4-fluorophenyl)acetaldehyde;hydrobromide (PubChem CID 173117931) has the molecular formula C15H11BrFNOS and a molecular weight of 352.23 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-2-(4-fluorophenyl)acetaldehyde;hydrobromide.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-2-(4-fluorophenyl)acetaldehyde;hydrobromide |
|---|---|
| PubChem CID | 173117931 |
| Molecular Formula | C15H11BrFNOS |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-2-(4-fluorophenyl)acetaldehyde;hydrobromide |
| SMILES | Br.O=CC(c1ccc(F)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H10FNOS.BrH/c16-11-7-5-10(6-8-11)12(9-18)15-17-13-3-1-2-4-14(13)19-15;/h1-9,12H;1H |
| InChIKey | OXKDMYKIFUYXHR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|