About disodium;hydride;tris(furan-2-yl)phosphane
disodium;hydride;tris(furan-2-yl)phosphane (PubChem CID 173122034) has the molecular formula C12H11Na2O3P
and a molecular weight of 280.17 g/mol. Its IUPAC name is disodium;hydride;tris(furan-2-yl)phosphane.
Molecular Properties
| Compound Name | disodium;hydride;tris(furan-2-yl)phosphane |
| PubChem CID | 173122034 |
| Molecular Formula | C12H11Na2O3P |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | disodium;hydride;tris(furan-2-yl)phosphane |
| SMILES | [H-].[H-].[Na+].[Na+].c1coc(P(c2ccco2)c2ccco2)c1 |
| InChI | InChI=1S/C12H9O3P.2Na.2H/c1-4-10(13-7-1)16(11-5-2-8-14-11)12-6-3-9-15-12;;;;/h1-9H;;;;/q;2*+1;2*-1 |
| InChIKey | OEAOOUNGTJDMKH-UHFFFAOYSA-N |
| XLogP | -3.54 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;hydride;tris(furan-2-yl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;hydride;tris(furan-2-yl)phosphane?
The IUPAC name of disodium;hydride;tris(furan-2-yl)phosphane (CID 173122034) is disodium;hydride;tris(furan-2-yl)phosphane.
What is the SMILES notation for disodium;hydride;tris(furan-2-yl)phosphane?
The canonical SMILES for disodium;hydride;tris(furan-2-yl)phosphane is [H-].[H-].[Na+].[Na+].c1coc(P(c2ccco2)c2ccco2)c1.
What is the InChIKey of disodium;hydride;tris(furan-2-yl)phosphane?
The InChIKey is OEAOOUNGTJDMKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9O3P.2Na.2H/c1-4-10(13-7-1)16(11-5-2-8-14-11)12-6-3-9-15-12;;;;/h1-9H;;;;/q;2*+1;2*-1.
What are the key properties of disodium;hydride;tris(furan-2-yl)phosphane?
disodium;hydride;tris(furan-2-yl)phosphane has a molecular weight of 280.17 g/mol, XLogP of -3.54, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;hydride;tris(furan-2-yl)phosphane is sourced from PubChem (CID 173122034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).