C26H26ClFN4O3 — CID 173143678
(4R,6S)-8-chloro-6-(2,3-dimethoxyphenyl)-4-[2-(4-ethyltriazol-1-yl)ethyl]-10-fluoro-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine (PubChem CID 173143678) has the molecular formula C26H26ClFN4O3 and a molecular weight of 496.97 g/mol. Its IUPAC name is (4R,6S)-8-chloro-6-(2,3-dimethoxyphenyl)-4-[2-(4-ethyltriazol-1-yl)ethyl]-10-fluoro-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine.
| Compound Name | (4R,6S)-8-chloro-6-(2,3-dimethoxyphenyl)-4-[2-(4-ethyltriazol-1-yl)ethyl]-10-fluoro-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine |
|---|---|
| PubChem CID | 173143678 |
| Molecular Formula | C26H26ClFN4O3 |
| Molecular Weight | 496.97 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | (4R,6S)-8-chloro-6-(2,3-dimethoxyphenyl)-4-[2-(4-ethyltriazol-1-yl)ethyl]-10-fluoro-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine |
| SMILES | CCc1cn(CC[C@H]2O[C@H](c3cccc(OC)c3OC)c3cc(Cl)cc(F)c3-n3cccc32)nn1 |
| InChI | InChI=1S/C26H26ClFN4O3/c1-4-17-15-31(30-29-17)12-10-22-21-8-6-11-32(21)24-19(13-16(27)14-20(24)28)25(35-22)18-7-5-9-23(33-2)26(18)34-3/h5-9,11,13-15,22,25H,4,10,12H2,1-3H3/t22-,25-/m1/s1 |
| InChIKey | CXLSFJUPNDXMLS-RCZVLFRGSA-N |
| XLogP | 5.69 |
| TPSA | 63.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.97 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |