C28H32ClN5O6 — CID 143456294
2-[2-amino-2-[2-[(4R,6S)-8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepin-4-yl]ethyliminohydrazinylidene]ethoxy]-2-methylpropanoic acid (PubChem CID 143456294) has the molecular formula C28H32ClN5O6 and a molecular weight of 570.05 g/mol. Its IUPAC name is 2-[2-amino-2-[2-[(4R,6S)-8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepin-4-yl]ethyliminohydrazinylidene]ethoxy]-2-methylpropanoic acid.
| Compound Name | 2-[2-amino-2-[2-[(4R,6S)-8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepin-4-yl]ethyliminohydrazinylidene]ethoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 143456294 |
| Molecular Formula | C28H32ClN5O6 |
| Molecular Weight | 570.05 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | 2-[2-amino-2-[2-[(4R,6S)-8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepin-4-yl]ethyliminohydrazinylidene]ethoxy]-2-methylpropanoic acid |
| SMILES | COc1cccc([C@H]2O[C@H](CC/N=N/N=C(N)COC(C)(C)C(=O)O)c3cccn3-c3ccc(Cl)cc32)c1OC |
| InChI | InChI=1S/C28H32ClN5O6/c1-28(2,27(35)36)39-16-24(30)32-33-31-13-12-22-21-8-6-14-34(21)20-11-10-17(29)15-19(20)25(40-22)18-7-5-9-23(37-3)26(18)38-4/h5-11,14-15,22,25H,12-13,16H2,1-4H3,(H,35,36)(H2,30,31,32)/t22-,25-/m1/s1 |
| InChIKey | UVUPWYYDNKDWEE-RCZVLFRGSA-N |
| XLogP | 5.30 |
| TPSA | 142.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.05 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|