C31H35ClN2O6 — CID 86632729
cis-ethyl (1S,2R)-2-[[2-[(4R,6S)-8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepin-4-yl]acetyl]amino]cyclohexane-1-carboxylate (PubChem CID 86632729) has the molecular formula C31H35ClN2O6 and a molecular weight of 567.08 g/mol. Its IUPAC name is cis-ethyl (1S,2R)-2-[[2-[(4R,6S)-8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepin-4-yl]acetyl]amino]cyclohexane-1-carboxylate.
| Compound Name | cis-ethyl (1S,2R)-2-[[2-[(4R,6S)-8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepin-4-yl]acetyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 86632729 |
| Molecular Formula | C31H35ClN2O6 |
| Molecular Weight | 567.08 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | cis-ethyl (1S,2R)-2-[[2-[(4R,6S)-8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepin-4-yl]acetyl]amino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCC[C@H]1NC(=O)C[C@H]1O[C@H](c2cccc(OC)c2OC)c2cc(Cl)ccc2-n2cccc21 |
| InChI | InChI=1S/C31H35ClN2O6/c1-4-39-31(36)20-9-5-6-11-23(20)33-28(35)18-27-25-12-8-16-34(25)24-15-14-19(32)17-22(24)29(40-27)21-10-7-13-26(37-2)30(21)38-3/h7-8,10,12-17,20,23,27,29H,4-6,9,11,18H2,1-3H3,(H,33,35)/t20-,23+,27+,29+/m0/s1 |
| InChIKey | AACJMJOUMXAVFO-ZDGQEMPXSA-N |
| XLogP | 5.94 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.08 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |