C31H33ClN2O6 — CID 68917169
ethyl 2-[1-[2-[(4R,6S)-8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepin-4-yl]acetyl]-3,6-dihydro-2H-pyridin-4-yl]acetate (PubChem CID 68917169) has the molecular formula C31H33ClN2O6 and a molecular weight of 565.07 g/mol. Its IUPAC name is ethyl 2-[1-[2-[(4R,6S)-8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepin-4-yl]acetyl]-3,6-dihydro-2H-pyridin-4-yl]acetate.
| Compound Name | ethyl 2-[1-[2-[(4R,6S)-8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepin-4-yl]acetyl]-3,6-dihydro-2H-pyridin-4-yl]acetate |
|---|---|
| PubChem CID | 68917169 |
| Molecular Formula | C31H33ClN2O6 |
| Molecular Weight | 565.07 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | ethyl 2-[1-[2-[(4R,6S)-8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepin-4-yl]acetyl]-3,6-dihydro-2H-pyridin-4-yl]acetate |
| SMILES | CCOC(=O)CC1=CCN(C(=O)C[C@H]2O[C@H](c3cccc(OC)c3OC)c3cc(Cl)ccc3-n3cccc32)CC1 |
| InChI | InChI=1S/C31H33ClN2O6/c1-4-39-29(36)17-20-12-15-33(16-13-20)28(35)19-27-25-8-6-14-34(25)24-11-10-21(32)18-23(24)30(40-27)22-7-5-9-26(37-2)31(22)38-3/h5-12,14,18,27,30H,4,13,15-17,19H2,1-3H3/t27-,30-/m1/s1 |
| InChIKey | UTUGDKLAZSYPAM-POURPWNDSA-N |
| XLogP | 5.81 |
| TPSA | 79.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.07 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|