C23H24ClNO6S — CID 76603203
2-[8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepin-4-yl]ethyl methanesulfonate (PubChem CID 76603203) has the molecular formula C23H24ClNO6S and a molecular weight of 477.97 g/mol. Its IUPAC name is 2-[8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepin-4-yl]ethyl methanesulfonate.
| Compound Name | 2-[8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepin-4-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 76603203 |
| Molecular Formula | C23H24ClNO6S |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 2-[8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepin-4-yl]ethyl methanesulfonate |
| SMILES | COc1cccc(C2OC(CCOS(C)(=O)=O)c3cccn3-c3ccc(Cl)cc32)c1OC |
| InChI | InChI=1S/C23H24ClNO6S/c1-28-21-8-4-6-16(23(21)29-2)22-17-14-15(24)9-10-18(17)25-12-5-7-19(25)20(31-22)11-13-30-32(3,26)27/h4-10,12,14,20,22H,11,13H2,1-3H3 |
| InChIKey | YCXHLUVGHMYMSV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|