C22H21ClN4O3 — CID 76602823
4-(2-azidoethyl)-8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine (PubChem CID 76602823) has the molecular formula C22H21ClN4O3 and a molecular weight of 424.89 g/mol. Its IUPAC name is 4-(2-azidoethyl)-8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine.
| Compound Name | 4-(2-azidoethyl)-8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine |
|---|---|
| PubChem CID | 76602823 |
| Molecular Formula | C22H21ClN4O3 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 4-(2-azidoethyl)-8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine |
| SMILES | COc1cccc(C2OC(CCN=[N+]=[N-])c3cccn3-c3ccc(Cl)cc32)c1OC |
| InChI | InChI=1S/C22H21ClN4O3/c1-28-20-7-3-5-15(22(20)29-2)21-16-13-14(23)8-9-17(16)27-12-4-6-18(27)19(30-21)10-11-25-26-24/h3-9,12-13,19,21H,10-11H2,1-2H3 |
| InChIKey | PBZRJHUBFLOTHK-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 81.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|