C32H37ClN3O8+ — CID 87622497
ethyl 2-[1-[4-[(4R,6S)-8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepin-4-yl]-3-hydroxybutanoyl]-3-oxopiperazin-1-ium-1-yl]acetate (PubChem CID 87622497) has the molecular formula C32H37ClN3O8+ and a molecular weight of 627.11 g/mol. Its IUPAC name is ethyl 2-[1-[4-[(4R,6S)-8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepin-4-yl]-3-hydroxybutanoyl]-3-oxopiperazin-1-ium-1-yl]acetate.
| Compound Name | ethyl 2-[1-[4-[(4R,6S)-8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepin-4-yl]-3-hydroxybutanoyl]-3-oxopiperazin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 87622497 |
| Molecular Formula | C32H37ClN3O8+ |
| Molecular Weight | 627.11 g/mol |
| Exact Mass | 626.23 |
| IUPAC Name | ethyl 2-[1-[4-[(4R,6S)-8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepin-4-yl]-3-hydroxybutanoyl]-3-oxopiperazin-1-ium-1-yl]acetate |
| SMILES | CCOC(=O)C[N+]1(C(=O)CC(O)C[C@H]2O[C@H](c3cccc(OC)c3OC)c3cc(Cl)ccc3-n3cccc32)CCNC(=O)C1 |
| InChI | InChI=1S/C32H36ClN3O8/c1-4-43-30(40)19-36(14-12-34-28(38)18-36)29(39)17-21(37)16-27-25-8-6-13-35(25)24-11-10-20(33)15-23(24)31(44-27)22-7-5-9-26(41-2)32(22)42-3/h5-11,13,15,21,27,31,37H,4,12,14,16-19H2,1-3H3/p+1/t21?,27-,31-,36?/m1/s1 |
| InChIKey | WKSOMDHOLHKFHO-UFXOLWSRSA-O |
| XLogP | 3.49 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.11 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|