C16H22Cl2N2O5 — CID 173145410
(3S)-2-chloro-5-[(2R)-3-[(4R)-4-(4-chlorophenoxy)-1,2-oxazolidin-2-yl]-2-hydroxypropoxy]pyrrolidin-3-ol (PubChem CID 173145410) has the molecular formula C16H22Cl2N2O5 and a molecular weight of 393.27 g/mol. Its IUPAC name is (3S)-2-chloro-5-[(2R)-3-[(4R)-4-(4-chlorophenoxy)-1,2-oxazolidin-2-yl]-2-hydroxypropoxy]pyrrolidin-3-ol.
| Compound Name | (3S)-2-chloro-5-[(2R)-3-[(4R)-4-(4-chlorophenoxy)-1,2-oxazolidin-2-yl]-2-hydroxypropoxy]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 173145410 |
| Molecular Formula | C16H22Cl2N2O5 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | (3S)-2-chloro-5-[(2R)-3-[(4R)-4-(4-chlorophenoxy)-1,2-oxazolidin-2-yl]-2-hydroxypropoxy]pyrrolidin-3-ol |
| SMILES | O[C@@H](COC1C[C@H](O)C(Cl)N1)CN1C[C@@H](Oc2ccc(Cl)cc2)CO1 |
| InChI | InChI=1S/C16H22Cl2N2O5/c17-10-1-3-12(4-2-10)25-13-7-20(24-9-13)6-11(21)8-23-15-5-14(22)16(18)19-15/h1-4,11,13-16,19,21-22H,5-9H2/t11-,13-,14+,15?,16?/m1/s1 |
| InChIKey | RXGHHAHSJFBGAQ-XTSOIUOTSA-N |
| XLogP | 0.96 |
| TPSA | 83.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|