C13H29NSi — CID 173154229
N-(3,7-dimethyloct-6-enylsilyl)propan-1-amine (PubChem CID 173154229) has the molecular formula C13H29NSi and a molecular weight of 227.47 g/mol. Its IUPAC name is N-(3,7-dimethyloct-6-enylsilyl)propan-1-amine.
| Compound Name | N-(3,7-dimethyloct-6-enylsilyl)propan-1-amine |
|---|---|
| PubChem CID | 173154229 |
| Molecular Formula | C13H29NSi |
| Molecular Weight | 227.47 g/mol |
| Exact Mass | 227.21 |
| IUPAC Name | N-(3,7-dimethyloct-6-enylsilyl)propan-1-amine |
| SMILES | CCCN[SiH2]CCC(C)CCC=C(C)C |
| InChI | InChI=1S/C13H29NSi/c1-5-10-14-15-11-9-13(4)8-6-7-12(2)3/h7,13-14H,5-6,8-11,15H2,1-4H3 |
| InChIKey | JZMJPRTULQNMQQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|