C15H16N2O3S — CID 173160940
N-[1-cyano-4-(4-hydroxy-3,5-dimethoxyphenyl)buta-1,3-dienyl]ethanethioamide (PubChem CID 173160940) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is N-[1-cyano-4-(4-hydroxy-3,5-dimethoxyphenyl)buta-1,3-dienyl]ethanethioamide.
| Compound Name | N-[1-cyano-4-(4-hydroxy-3,5-dimethoxyphenyl)buta-1,3-dienyl]ethanethioamide |
|---|---|
| PubChem CID | 173160940 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | N-[1-cyano-4-(4-hydroxy-3,5-dimethoxyphenyl)buta-1,3-dienyl]ethanethioamide |
| SMILES | COc1cc(C=CC=C(C#N)NC(C)=S)cc(OC)c1O |
| InChI | InChI=1S/C15H16N2O3S/c1-10(21)17-12(9-16)6-4-5-11-7-13(19-2)15(18)14(8-11)20-3/h4-8,18H,1-3H3,(H,17,21) |
| InChIKey | ZFMGGZGAFBRPPX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 74.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|